C10H23N3O — CID 15920060
5,8,10-triaminodecan-2-one (PubChem CID 15920060) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 5,8,10-triaminodecan-2-one.
| Compound Name | 5,8,10-triaminodecan-2-one |
|---|---|
| PubChem CID | 15920060 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 5,8,10-triaminodecan-2-one |
| SMILES | CC(=O)CCC(N)CCC(N)CCN |
| InChI | InChI=1S/C10H23N3O/c1-8(14)2-3-9(12)4-5-10(13)6-7-11/h9-10H,2-7,11-13H2,1H3 |
| InChIKey | QYSUQSIYEMOJNR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |