C10H21NO2 — CID 155584486
3-aminoheptane-2,6-dione;propane (PubChem CID 155584486) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 3-aminoheptane-2,6-dione;propane.
| Compound Name | 3-aminoheptane-2,6-dione;propane |
|---|---|
| PubChem CID | 155584486 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3-aminoheptane-2,6-dione;propane |
| SMILES | CC(=O)CCC(N)C(C)=O.CCC |
| InChI | InChI=1S/C7H13NO2.C3H8/c1-5(9)3-4-7(8)6(2)10;1-3-2/h7H,3-4,8H2,1-2H3;3H2,1-2H3 |
| InChIKey | ISXCTSYMOALTTE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |