C12H24N2O7 — CID 163711224
(4R)-4-amino-5-oxohexanoic acid;(2S)-2-aminopentanedioic acid;methane (PubChem CID 163711224) has the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. Its IUPAC name is (4R)-4-amino-5-oxohexanoic acid;(2S)-2-aminopentanedioic acid;methane.
| Compound Name | (4R)-4-amino-5-oxohexanoic acid;(2S)-2-aminopentanedioic acid;methane |
|---|---|
| PubChem CID | 163711224 |
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4R)-4-amino-5-oxohexanoic acid;(2S)-2-aminopentanedioic acid;methane |
| SMILES | C.CC(=O)[C@H](N)CCC(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO3.C5H9NO4.CH4/c1-4(8)5(7)2-3-6(9)10;6-3(5(9)10)1-2-4(7)8;/h5H,2-3,7H2,1H3,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10);1H4/t5-;3-;/m10./s1 |
| InChIKey | KJJQSIYDFFKCCQ-JJHGZLQRSA-N |
| XLogP | -0.33 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |