C7H13NO2 — CID 161440534
3-(dideuterioamino)(613C)heptane-2,6-dione (PubChem CID 161440534) has the molecular formula C7H13NO2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-(dideuterioamino)(613C)heptane-2,6-dione.
| Compound Name | 3-(dideuterioamino)(613C)heptane-2,6-dione |
|---|---|
| PubChem CID | 161440534 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-(dideuterioamino)(613C)heptane-2,6-dione |
| SMILES | [2H]N([2H])C(CC[13C](C)=O)C(C)=O |
| InChI | InChI=1S/C7H13NO2/c1-5(9)3-4-7(8)6(2)10/h7H,3-4,8H2,1-2H3/i5+1/hD2 |
| InChIKey | VZFDEQFDNNVMOS-XNUBCHNNSA-N |
| XLogP | 0.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |