(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid

C5H10N2O3 — CID 175722488

IUPAC(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid
SMILES[2H]N([2H])[C@@H](CCC(N)=O)C(=O)O
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i/hD2
InChIKeyZDXPYRJPNDTMRX-ULWXGCIASA-N
MW148.16 g/mol
LogP-1.34
Rot. Bonds5

About (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid

(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid (PubChem CID 175722488) has the molecular formula C5H10N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid
PubChem CID175722488
Molecular FormulaC5H10N2O3
Molecular Weight148.16 g/mol
Exact Mass148.08
IUPAC Name(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid
SMILES[2H]N([2H])[C@@H](CCC(N)=O)C(=O)O
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i/hD2
InChIKeyZDXPYRJPNDTMRX-ULWXGCIASA-N
XLogP-1.34
TPSA106.41 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.16
LogP ≤ 5-1.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid?
The IUPAC name of (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid (CID 175722488) is (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid.
What is the SMILES notation for (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid?
The canonical SMILES for (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid is [2H]N([2H])[C@@H](CCC(N)=O)C(=O)O.
What is the InChIKey of (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid?
The InChIKey is ZDXPYRJPNDTMRX-ULWXGCIASA-N. The full InChI is InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i/hD2.
What are the key properties of (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid?
(2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid has a molecular weight of 148.16 g/mol, XLogP of -1.34, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-amino-2-(dideuterioamino)-5-oxopentanoic acid is sourced from PubChem (CID 175722488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).