C8H14N2O6 — CID 157421085
2,5-diamino-5-oxo(513C)pentanoic acid;2-oxo(113C)propanoic acid (PubChem CID 157421085) has the molecular formula C8H14N2O6 and a molecular weight of 236.19 g/mol. Its IUPAC name is 2,5-diamino-5-oxo(513C)pentanoic acid;2-oxo(113C)propanoic acid.
| Compound Name | 2,5-diamino-5-oxo(513C)pentanoic acid;2-oxo(113C)propanoic acid |
|---|---|
| PubChem CID | 157421085 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2,5-diamino-5-oxo(513C)pentanoic acid;2-oxo(113C)propanoic acid |
| SMILES | CC(=O)[13C](=O)O.NC(CC[13C](N)=O)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C3H4O3/c6-3(5(9)10)1-2-4(7)8;1-2(4)3(5)6/h3H,1-2,6H2,(H2,7,8)(H,9,10);1H3,(H,5,6)/i4+1;3+1 |
| InChIKey | BPKJYWOWUZLUMZ-BUWGGSAVSA-N |
| XLogP | -1.68 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|