C10H21ClN2O3 — CID 159202405
(2S)-2,5-diamino-5-oxopentanoic acid;2-methylbut-2-ene;hydrochloride (PubChem CID 159202405) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-oxopentanoic acid;2-methylbut-2-ene;hydrochloride.
| Compound Name | (2S)-2,5-diamino-5-oxopentanoic acid;2-methylbut-2-ene;hydrochloride |
|---|---|
| PubChem CID | 159202405 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2S)-2,5-diamino-5-oxopentanoic acid;2-methylbut-2-ene;hydrochloride |
| SMILES | CC=C(C)C.Cl.NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C5H10.ClH/c6-3(5(9)10)1-2-4(7)8;1-4-5(2)3;/h3H,1-2,6H2,(H2,7,8)(H,9,10);4H,1-3H3;1H/t3-;;/m0../s1 |
| InChIKey | YDQBIJLGSFTYQX-QTNFYWBSSA-N |
| XLogP | 1.06 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|