C8H13N2NaO6 — CID 87359463
sodium;(2S)-2,5-diamino-5-oxopentanoic acid;2-oxopropanoate (PubChem CID 87359463) has the molecular formula C8H13N2NaO6 and a molecular weight of 256.19 g/mol. Its IUPAC name is sodium;(2S)-2,5-diamino-5-oxopentanoic acid;2-oxopropanoate.
| Compound Name | sodium;(2S)-2,5-diamino-5-oxopentanoic acid;2-oxopropanoate |
|---|---|
| PubChem CID | 87359463 |
| Molecular Formula | C8H13N2NaO6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | sodium;(2S)-2,5-diamino-5-oxopentanoic acid;2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].NC(=O)CC[C@H](N)C(=O)O.[Na+] |
| InChI | InChI=1S/C5H10N2O3.C3H4O3.Na/c6-3(5(9)10)1-2-4(7)8;1-2(4)3(5)6;/h3H,1-2,6H2,(H2,7,8)(H,9,10);1H3,(H,5,6);/q;;+1/p-1/t3-;;/m0../s1 |
| InChIKey | OWPYRRQQCJKSOL-QTNFYWBSSA-M |
| XLogP | -6.01 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|