About amino 4-amino-5-oxohexanoate
amino 4-amino-5-oxohexanoate (PubChem CID 87413012) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is amino 4-amino-5-oxohexanoate.
Molecular Properties
| Compound Name | amino 4-amino-5-oxohexanoate |
| PubChem CID | 87413012 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | amino 4-amino-5-oxohexanoate |
| SMILES | CC(=O)C(N)CCC(=O)ON |
| InChI | InChI=1S/C6H12N2O3/c1-4(9)5(7)2-3-6(10)11-8/h5H,2-3,7-8H2,1H3 |
| InChIKey | HUMTWVNIQMCMAI-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 4-amino-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-amino-5-oxohexanoate?
The IUPAC name of amino 4-amino-5-oxohexanoate (CID 87413012) is amino 4-amino-5-oxohexanoate.
What is the SMILES notation for amino 4-amino-5-oxohexanoate?
The canonical SMILES for amino 4-amino-5-oxohexanoate is CC(=O)C(N)CCC(=O)ON.
What is the InChIKey of amino 4-amino-5-oxohexanoate?
The InChIKey is HUMTWVNIQMCMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-4(9)5(7)2-3-6(10)11-8/h5H,2-3,7-8H2,1H3.
What are the key properties of amino 4-amino-5-oxohexanoate?
amino 4-amino-5-oxohexanoate has a molecular weight of 160.17 g/mol, XLogP of -0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-amino-5-oxohexanoate is sourced from PubChem (CID 87413012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).