C6H13NO3 — CID 91613059
3-amino-6,6-dihydroxyhexan-2-one (PubChem CID 91613059) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 3-amino-6,6-dihydroxyhexan-2-one.
| Compound Name | 3-amino-6,6-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 91613059 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 3-amino-6,6-dihydroxyhexan-2-one |
| SMILES | CC(=O)C(N)CCC(O)O |
| InChI | InChI=1S/C6H13NO3/c1-4(8)5(7)2-3-6(9)10/h5-6,9-10H,2-3,7H2,1H3 |
| InChIKey | FLPFYSFPYXYDNL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|