C5H11NO3 — CID 20668323
3-amino-5,5-dihydroxypentan-2-one (PubChem CID 20668323) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 3-amino-5,5-dihydroxypentan-2-one.
| Compound Name | 3-amino-5,5-dihydroxypentan-2-one |
|---|---|
| PubChem CID | 20668323 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 3-amino-5,5-dihydroxypentan-2-one |
| SMILES | CC(=O)C(N)CC(O)O |
| InChI | InChI=1S/C5H11NO3/c1-3(7)4(6)2-5(8)9/h4-5,8-9H,2,6H2,1H3 |
| InChIKey | DNWBRHIOWWVOEI-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|