C10H18N2O2 — CID 166997414
(Z,3S,8S)-3,8-diaminodec-5-ene-2,9-dione (PubChem CID 166997414) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (Z,3S,8S)-3,8-diaminodec-5-ene-2,9-dione.
| Compound Name | (Z,3S,8S)-3,8-diaminodec-5-ene-2,9-dione |
|---|---|
| PubChem CID | 166997414 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (Z,3S,8S)-3,8-diaminodec-5-ene-2,9-dione |
| SMILES | CC(=O)[C@@H](N)C/C=C\C[C@H](N)C(C)=O |
| InChI | InChI=1S/C10H18N2O2/c1-7(13)9(11)5-3-4-6-10(12)8(2)14/h3-4,9-10H,5-6,11-12H2,1-2H3/b4-3-/t9-,10-/m0/s1 |
| InChIKey | DLGYWIGFKVCJPA-CMIOBCHKSA-N |
| XLogP | 0.16 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|