C6H11NO4S — CID 174239098
(2S)-2-amino-5-methylsulfonylpent-4-enoic acid (PubChem CID 174239098) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is (2S)-2-amino-5-methylsulfonylpent-4-enoic acid.
| Compound Name | (2S)-2-amino-5-methylsulfonylpent-4-enoic acid |
|---|---|
| PubChem CID | 174239098 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (2S)-2-amino-5-methylsulfonylpent-4-enoic acid |
| SMILES | CS(=O)(=O)C=CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-12(10,11)4-2-3-5(7)6(8)9/h2,4-5H,3,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | PLIYGGRLIHVCRN-YFKPBYRVSA-N |
| XLogP | -0.65 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |