C6H12N4O2 — CID 130144807
(E)-2-amino-5-(diaminomethylideneamino)pent-4-enoic acid (PubChem CID 130144807) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is (E)-2-amino-5-(diaminomethylideneamino)pent-4-enoic acid.
| Compound Name | (E)-2-amino-5-(diaminomethylideneamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 130144807 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (E)-2-amino-5-(diaminomethylideneamino)pent-4-enoic acid |
| SMILES | NC(N)=N/C=C/CC(N)C(=O)O |
| InChI | InChI=1S/C6H12N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h1,3-4H,2,7H2,(H,11,12)(H4,8,9,10)/b3-1+ |
| InChIKey | FVSQXMGZDMFDEJ-HNQUOIGGSA-N |
| XLogP | -1.42 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|