C5H12N4O2 — CID 11389551
(2S)-2-amino-4-(diaminomethylideneamino)butanoic acid (PubChem CID 11389551) has the molecular formula C5H12N4O2 and a molecular weight of 160.18 g/mol. Its IUPAC name is (2S)-2-amino-4-(diaminomethylideneamino)butanoic acid.
| Compound Name | (2S)-2-amino-4-(diaminomethylideneamino)butanoic acid |
|---|---|
| PubChem CID | 11389551 |
| Molecular Formula | C5H12N4O2 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (2S)-2-amino-4-(diaminomethylideneamino)butanoic acid |
| SMILES | NC(N)=NCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N4O2/c6-3(4(10)11)1-2-9-5(7)8/h3H,1-2,6H2,(H,10,11)(H4,7,8,9)/t3-/m0/s1 |
| InChIKey | IFPQOXNWLSRZKX-VKHMYHEASA-N |
| XLogP | -1.94 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|