C7H16N4O3 — CID 5318222
(2R,4R)-2-amino-6-(diaminomethylideneamino)-4-hydroxyhexanoic acid (PubChem CID 5318222) has the molecular formula C7H16N4O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2R,4R)-2-amino-6-(diaminomethylideneamino)-4-hydroxyhexanoic acid.
| Compound Name | (2R,4R)-2-amino-6-(diaminomethylideneamino)-4-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 5318222 |
| Molecular Formula | C7H16N4O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,4R)-2-amino-6-(diaminomethylideneamino)-4-hydroxyhexanoic acid |
| SMILES | NC(N)=NCC[C@@H](O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O3/c8-5(6(13)14)3-4(12)1-2-11-7(9)10/h4-5,12H,1-3,8H2,(H,13,14)(H4,9,10,11)/t4-,5-/m1/s1 |
| InChIKey | UFBPWFODSIJGPL-RFZPGFLSSA-N |
| XLogP | -2.19 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|