C8H14N2O4 — CID 22297949
(E)-2,6-diamino-2-methylhept-3-enedioic acid (PubChem CID 22297949) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is (E)-2,6-diamino-2-methylhept-3-enedioic acid.
| Compound Name | (E)-2,6-diamino-2-methylhept-3-enedioic acid |
|---|---|
| PubChem CID | 22297949 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (E)-2,6-diamino-2-methylhept-3-enedioic acid |
| SMILES | CC(N)(/C=C/CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O4/c1-8(10,7(13)14)4-2-3-5(9)6(11)12/h2,4-5H,3,9-10H2,1H3,(H,11,12)(H,13,14)/b4-2+ |
| InChIKey | KZTBZMKHDWRBTP-DUXPYHPUSA-N |
| XLogP | -0.85 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|