C5H11NO7S — CID 87903305
2-aminobutanedioic acid;methanesulfonic acid (PubChem CID 87903305) has the molecular formula C5H11NO7S and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-aminobutanedioic acid;methanesulfonic acid.
| Compound Name | 2-aminobutanedioic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 87903305 |
| Molecular Formula | C5H11NO7S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-aminobutanedioic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4.CH4O3S/c5-2(4(8)9)1-3(6)7;1-5(2,3)4/h2H,1,5H2,(H,6,7)(H,8,9);1H3,(H,2,3,4) |
| InChIKey | ZGFVVZXWVAVCNX-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|