C10H21N3O8 — CID 154929079
2-aminobutanedioic acid;bis(2-aminopropanoic acid) (PubChem CID 154929079) has the molecular formula C10H21N3O8 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-aminobutanedioic acid;bis(2-aminopropanoic acid).
| Compound Name | 2-aminobutanedioic acid;bis(2-aminopropanoic acid) |
|---|---|
| PubChem CID | 154929079 |
| Molecular Formula | C10H21N3O8 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-aminobutanedioic acid;bis(2-aminopropanoic acid) |
| SMILES | CC(N)C(=O)O.CC(N)C(=O)O.NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4.2C3H7NO2/c5-2(4(8)9)1-3(6)7;2*1-2(4)3(5)6/h2H,1,5H2,(H,6,7)(H,8,9);2*2H,4H2,1H3,(H,5,6) |
| InChIKey | JZQSWARDGJQWLY-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 227.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |