2-amino-4-hydroxypentanoic acid

C5H11NO3 — CID 14021586

IUPAC2-amino-4-hydroxypentanoic acid
SMILESCC(O)CC(N)C(=O)O
InChIInChI=1S/C5H11NO3/c1-3(7)2-4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9)
InChIKeySBRVJFMQKPUAGQ-UHFFFAOYSA-N
MW133.15 g/mol
LogP-0.83
Rot. Bonds3

About 2-amino-4-hydroxypentanoic acid

2-amino-4-hydroxypentanoic acid (PubChem CID 14021586) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-amino-4-hydroxypentanoic acid.

Molecular Properties

Compound Name2-amino-4-hydroxypentanoic acid
PubChem CID14021586
Molecular FormulaC5H11NO3
Molecular Weight133.15 g/mol
Exact Mass133.07
IUPAC Name2-amino-4-hydroxypentanoic acid
SMILESCC(O)CC(N)C(=O)O
InChIInChI=1S/C5H11NO3/c1-3(7)2-4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9)
InChIKeySBRVJFMQKPUAGQ-UHFFFAOYSA-N
XLogP-0.83
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.15
LogP ≤ 5-0.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-amino-4-hydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-4-hydroxypentanoic acid;ethane
CID 143364485
(2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid
CID 71309151
2-amino-4-methylpentanoic acid;chromium
CID 88640601
(2S)-2-amino-4-methylpentanoic acid;hydrazine
CID 160824424
(2S)-2-amino-4-methylpentanoic acid;cerium
CID 86698944
CID 6369563
CID 6369563
(2R,4R)-2-amino-4-fluoropentanoic acid
CID 55283897
sodium;(2S)-2-amino-4-methylpentanoic acid;hydride
CID 173065319
(2S)-2-amino-4-deuterio-4-methylpentanoic acid
CID 71309041
(2S)-2-amino-4-methylpentanoic acid;oxovanadium
CID 175017880
bis((2S)-2-amino-4-methylpentanoic acid);bis((2S)-2-aminopropanoic acid)
CID 57354298
(2R)-2-amino-4-hydroxypentanedioic acid
CID 59133640

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-hydroxypentanoic acid?
The IUPAC name of 2-amino-4-hydroxypentanoic acid (CID 14021586) is 2-amino-4-hydroxypentanoic acid.
What is the SMILES notation for 2-amino-4-hydroxypentanoic acid?
The canonical SMILES for 2-amino-4-hydroxypentanoic acid is CC(O)CC(N)C(=O)O.
What is the InChIKey of 2-amino-4-hydroxypentanoic acid?
The InChIKey is SBRVJFMQKPUAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-3(7)2-4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9).
What are the key properties of 2-amino-4-hydroxypentanoic acid?
2-amino-4-hydroxypentanoic acid has a molecular weight of 133.15 g/mol, XLogP of -0.83, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-hydroxypentanoic acid is sourced from PubChem (CID 14021586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).