(2S)-2-amino-4-deuterio-4-methylpentanoic acid

C6H13NO2 — CID 71309041

IUPAC(2S)-2-amino-4-deuterio-4-methylpentanoic acid
SMILES[2H]C(C)(C)C[C@H](N)C(=O)O
InChIInChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i4D
InChIKeyROHFNLRQFUQHCH-HHMJLCMQSA-N
MW132.18 g/mol
LogP0.44
Rot. Bonds3

About (2S)-2-amino-4-deuterio-4-methylpentanoic acid

(2S)-2-amino-4-deuterio-4-methylpentanoic acid (PubChem CID 71309041) has the molecular formula C6H13NO2 and a molecular weight of 132.18 g/mol. Its IUPAC name is (2S)-2-amino-4-deuterio-4-methylpentanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-4-deuterio-4-methylpentanoic acid
PubChem CID71309041
Molecular FormulaC6H13NO2
Molecular Weight132.18 g/mol
Exact Mass132.10
IUPAC Name(2S)-2-amino-4-deuterio-4-methylpentanoic acid
SMILES[2H]C(C)(C)C[C@H](N)C(=O)O
InChIInChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i4D
InChIKeyROHFNLRQFUQHCH-HHMJLCMQSA-N
XLogP0.44
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.18
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-amino-4-deuterio-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-4-deuterio-4-methylpentanoic acid?
The IUPAC name of (2S)-2-amino-4-deuterio-4-methylpentanoic acid (CID 71309041) is (2S)-2-amino-4-deuterio-4-methylpentanoic acid.
What is the SMILES notation for (2S)-2-amino-4-deuterio-4-methylpentanoic acid?
The canonical SMILES for (2S)-2-amino-4-deuterio-4-methylpentanoic acid is [2H]C(C)(C)C[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-deuterio-4-methylpentanoic acid?
The InChIKey is ROHFNLRQFUQHCH-HHMJLCMQSA-N. The full InChI is InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i4D.
What are the key properties of (2S)-2-amino-4-deuterio-4-methylpentanoic acid?
(2S)-2-amino-4-deuterio-4-methylpentanoic acid has a molecular weight of 132.18 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-deuterio-4-methylpentanoic acid is sourced from PubChem (CID 71309041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).