(2R)-2-amino-4-hydroxypentanedioic acid

C5H9NO5 — CID 59133640

IUPAC(2R)-2-amino-4-hydroxypentanedioic acid
SMILESN[C@H](CC(O)C(=O)O)C(=O)O
InChIInChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/t2-,3?/m1/s1
InChIKeyHBDWQSHEVMSFGY-STYMGOOTSA-N
MW163.13 g/mol
LogP-1.77
Rot. Bonds4

About (2R)-2-amino-4-hydroxypentanedioic acid

(2R)-2-amino-4-hydroxypentanedioic acid (PubChem CID 59133640) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is (2R)-2-amino-4-hydroxypentanedioic acid.

Molecular Properties

Compound Name(2R)-2-amino-4-hydroxypentanedioic acid
PubChem CID59133640
Molecular FormulaC5H9NO5
Molecular Weight163.13 g/mol
Exact Mass163.05
IUPAC Name(2R)-2-amino-4-hydroxypentanedioic acid
SMILESN[C@H](CC(O)C(=O)O)C(=O)O
InChIInChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/t2-,3?/m1/s1
InChIKeyHBDWQSHEVMSFGY-STYMGOOTSA-N
XLogP-1.77
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.13
LogP ≤ 5-1.77
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2R)-2-amino-4-hydroxypentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-aminobutanedioic acid;2-hydroxybutanedioic acid
CID 87166699
2,4,6-triaminoheptanedioic acid
CID 71362819
2-amino-4-hydroxypentanoic acid
CID 14021586
(4S)-2-amino-4,5-dihydroxypentanoic acid
CID 58205958
2-amino-4-hydroxypentanoic acid;ethane
CID 143364485
3-hydroxypropane-1,1,3-tricarboxylic acid
CID 150529276
(2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid
CID 71309151
(2S)-2-amino-4-(114C)methyl(514C)pentanoic acid
CID 10240856
2-amino-4-methylpentanoic acid;chromium
CID 88640601
(2S)-2-amino-4,4-difluorobutanoic acid;hydrochloride
CID 87593555
(2S)-2-amino-4-methylpentanoic acid;cerium
CID 86698944
(2S)-2-amino-4-methylpentanoic acid;hydrazine
CID 160824424

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-4-hydroxypentanedioic acid?
The IUPAC name of (2R)-2-amino-4-hydroxypentanedioic acid (CID 59133640) is (2R)-2-amino-4-hydroxypentanedioic acid.
What is the SMILES notation for (2R)-2-amino-4-hydroxypentanedioic acid?
The canonical SMILES for (2R)-2-amino-4-hydroxypentanedioic acid is N[C@H](CC(O)C(=O)O)C(=O)O.
What is the InChIKey of (2R)-2-amino-4-hydroxypentanedioic acid?
The InChIKey is HBDWQSHEVMSFGY-STYMGOOTSA-N. The full InChI is InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/t2-,3?/m1/s1.
What are the key properties of (2R)-2-amino-4-hydroxypentanedioic acid?
(2R)-2-amino-4-hydroxypentanedioic acid has a molecular weight of 163.13 g/mol, XLogP of -1.77, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-hydroxypentanedioic acid is sourced from PubChem (CID 59133640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).