C7H15N3O4 — CID 71362819
2,4,6-triaminoheptanedioic acid (PubChem CID 71362819) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2,4,6-triaminoheptanedioic acid.
| Compound Name | 2,4,6-triaminoheptanedioic acid |
|---|---|
| PubChem CID | 71362819 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,4,6-triaminoheptanedioic acid |
| SMILES | NC(CC(N)C(=O)O)CC(N)C(=O)O |
| InChI | InChI=1S/C7H15N3O4/c8-3(1-4(9)6(11)12)2-5(10)7(13)14/h3-5H,1-2,8-10H2,(H,11,12)(H,13,14) |
| InChIKey | DYDIAQYPMYZMDR-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |