C8H13NO9 — CID 87166699
2-aminobutanedioic acid;2-hydroxybutanedioic acid (PubChem CID 87166699) has the molecular formula C8H13NO9 and a molecular weight of 267.19 g/mol. Its IUPAC name is 2-aminobutanedioic acid;2-hydroxybutanedioic acid.
| Compound Name | 2-aminobutanedioic acid;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87166699 |
| Molecular Formula | C8H13NO9 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-aminobutanedioic acid;2-hydroxybutanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H7NO4.C4H6O5/c2*5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | NBIPQJXKGATNAC-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |