About 3-aminooctan-2-one;hydrochloride
3-aminooctan-2-one;hydrochloride (PubChem CID 13478908) has the molecular formula C8H18ClNO
and a molecular weight of 179.69 g/mol. Its IUPAC name is 3-aminooctan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-aminooctan-2-one;hydrochloride |
| PubChem CID | 13478908 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-aminooctan-2-one;hydrochloride |
| SMILES | CCCCCC(N)C(C)=O.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-3-4-5-6-8(9)7(2)10;/h8H,3-6,9H2,1-2H3;1H |
| InChIKey | RRLALLMDYPQZAH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminooctan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminooctan-2-one;hydrochloride?
The IUPAC name of 3-aminooctan-2-one;hydrochloride (CID 13478908) is 3-aminooctan-2-one;hydrochloride.
What is the SMILES notation for 3-aminooctan-2-one;hydrochloride?
The canonical SMILES for 3-aminooctan-2-one;hydrochloride is CCCCCC(N)C(C)=O.Cl.
What is the InChIKey of 3-aminooctan-2-one;hydrochloride?
The InChIKey is RRLALLMDYPQZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.ClH/c1-3-4-5-6-8(9)7(2)10;/h8H,3-6,9H2,1-2H3;1H.
What are the key properties of 3-aminooctan-2-one;hydrochloride?
3-aminooctan-2-one;hydrochloride has a molecular weight of 179.69 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminooctan-2-one;hydrochloride is sourced from PubChem (CID 13478908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).