About 2-aminododecanamide;hydrochloride
2-aminododecanamide;hydrochloride (PubChem CID 14881390) has the molecular formula C12H27ClN2O
and a molecular weight of 250.81 g/mol. Its IUPAC name is 2-aminododecanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-aminododecanamide;hydrochloride |
| PubChem CID | 14881390 |
| Molecular Formula | C12H27ClN2O |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-aminododecanamide;hydrochloride |
| SMILES | CCCCCCCCCCC(N)C(N)=O.Cl |
| InChI | InChI=1S/C12H26N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11H,2-10,13H2,1H3,(H2,14,15);1H |
| InChIKey | IXRICKCNWPORMX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminododecanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminododecanamide;hydrochloride?
The IUPAC name of 2-aminododecanamide;hydrochloride (CID 14881390) is 2-aminododecanamide;hydrochloride.
What is the SMILES notation for 2-aminododecanamide;hydrochloride?
The canonical SMILES for 2-aminododecanamide;hydrochloride is CCCCCCCCCCC(N)C(N)=O.Cl.
What is the InChIKey of 2-aminododecanamide;hydrochloride?
The InChIKey is IXRICKCNWPORMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11H,2-10,13H2,1H3,(H2,14,15);1H.
What are the key properties of 2-aminododecanamide;hydrochloride?
2-aminododecanamide;hydrochloride has a molecular weight of 250.81 g/mol, XLogP of 2.75, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminododecanamide;hydrochloride is sourced from PubChem (CID 14881390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).