About heptyl 4-amino-5-oxohexanoate
heptyl 4-amino-5-oxohexanoate (PubChem CID 145221030) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is heptyl 4-amino-5-oxohexanoate.
Molecular Properties
| Compound Name | heptyl 4-amino-5-oxohexanoate |
| PubChem CID | 145221030 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | heptyl 4-amino-5-oxohexanoate |
| SMILES | CCCCCCCOC(=O)CCC(N)C(C)=O |
| InChI | InChI=1S/C13H25NO3/c1-3-4-5-6-7-10-17-13(16)9-8-12(14)11(2)15/h12H,3-10,14H2,1-2H3 |
| InChIKey | FYMAHZUJFNJTIH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl 4-amino-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 4-amino-5-oxohexanoate?
The IUPAC name of heptyl 4-amino-5-oxohexanoate (CID 145221030) is heptyl 4-amino-5-oxohexanoate.
What is the SMILES notation for heptyl 4-amino-5-oxohexanoate?
The canonical SMILES for heptyl 4-amino-5-oxohexanoate is CCCCCCCOC(=O)CCC(N)C(C)=O.
What is the InChIKey of heptyl 4-amino-5-oxohexanoate?
The InChIKey is FYMAHZUJFNJTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-4-5-6-7-10-17-13(16)9-8-12(14)11(2)15/h12H,3-10,14H2,1-2H3.
What are the key properties of heptyl 4-amino-5-oxohexanoate?
heptyl 4-amino-5-oxohexanoate has a molecular weight of 243.35 g/mol, XLogP of 2.20, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 4-amino-5-oxohexanoate is sourced from PubChem (CID 145221030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).