About 5,9-diaminononan-2-one
5,9-diaminononan-2-one (PubChem CID 175346024) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 5,9-diaminononan-2-one.
Molecular Properties
| Compound Name | 5,9-diaminononan-2-one |
| PubChem CID | 175346024 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 5,9-diaminononan-2-one |
| SMILES | CC(=O)CCC(N)CCCCN |
| InChI | InChI=1S/C9H20N2O/c1-8(12)5-6-9(11)4-2-3-7-10/h9H,2-7,10-11H2,1H3 |
| InChIKey | CVKFUHSUQYNGJN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,9-diaminononan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-diaminononan-2-one?
The IUPAC name of 5,9-diaminononan-2-one (CID 175346024) is 5,9-diaminononan-2-one.
What is the SMILES notation for 5,9-diaminononan-2-one?
The canonical SMILES for 5,9-diaminononan-2-one is CC(=O)CCC(N)CCCCN.
What is the InChIKey of 5,9-diaminononan-2-one?
The InChIKey is CVKFUHSUQYNGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-8(12)5-6-9(11)4-2-3-7-10/h9H,2-7,10-11H2,1H3.
What are the key properties of 5,9-diaminononan-2-one?
5,9-diaminononan-2-one has a molecular weight of 172.27 g/mol, XLogP of 0.81, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-diaminononan-2-one is sourced from PubChem (CID 175346024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).