C10H20N2O2 — CID 87488764
3-amino-4-(4-aminobutyl)hexane-2,5-dione (PubChem CID 87488764) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-amino-4-(4-aminobutyl)hexane-2,5-dione.
| Compound Name | 3-amino-4-(4-aminobutyl)hexane-2,5-dione |
|---|---|
| PubChem CID | 87488764 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-amino-4-(4-aminobutyl)hexane-2,5-dione |
| SMILES | CC(=O)C(N)C(CCCCN)C(C)=O |
| InChI | InChI=1S/C10H20N2O2/c1-7(13)9(5-3-4-6-11)10(12)8(2)14/h9-10H,3-6,11-12H2,1-2H3 |
| InChIKey | QKLSWFYKYHTTOW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|