C12H26N2O2 — CID 155444691
tert-butyl 4,8-diaminooctanoate (PubChem CID 155444691) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is tert-butyl 4,8-diaminooctanoate.
| Compound Name | tert-butyl 4,8-diaminooctanoate |
|---|---|
| PubChem CID | 155444691 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | tert-butyl 4,8-diaminooctanoate |
| SMILES | CC(C)(C)OC(=O)CCC(N)CCCCN |
| InChI | InChI=1S/C12H26N2O2/c1-12(2,3)16-11(15)8-7-10(14)6-4-5-9-13/h10H,4-9,13-14H2,1-3H3 |
| InChIKey | YWENCIFHGLEYSD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|