About tert-butyl (4R)-4-aminopentanoate
tert-butyl (4R)-4-aminopentanoate (PubChem CID 58781983) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is tert-butyl (4R)-4-aminopentanoate.
Molecular Properties
| Compound Name | tert-butyl (4R)-4-aminopentanoate |
| PubChem CID | 58781983 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | tert-butyl (4R)-4-aminopentanoate |
| SMILES | C[C@@H](N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19NO2/c1-7(10)5-6-8(11)12-9(2,3)4/h7H,5-6,10H2,1-4H3/t7-/m1/s1 |
| InChIKey | WAOWMAGPPDFHBR-SSDOTTSWSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (4R)-4-aminopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R)-4-aminopentanoate?
The IUPAC name of tert-butyl (4R)-4-aminopentanoate (CID 58781983) is tert-butyl (4R)-4-aminopentanoate.
What is the SMILES notation for tert-butyl (4R)-4-aminopentanoate?
The canonical SMILES for tert-butyl (4R)-4-aminopentanoate is C[C@@H](N)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (4R)-4-aminopentanoate?
The InChIKey is WAOWMAGPPDFHBR-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H19NO2/c1-7(10)5-6-8(11)12-9(2,3)4/h7H,5-6,10H2,1-4H3/t7-/m1/s1.
What are the key properties of tert-butyl (4R)-4-aminopentanoate?
tert-butyl (4R)-4-aminopentanoate has a molecular weight of 173.26 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R)-4-aminopentanoate is sourced from PubChem (CID 58781983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).