About ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate
ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate (PubChem CID 88883424) has the molecular formula C22H41NO6
and a molecular weight of 415.57 g/mol. Its IUPAC name is ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate.
Molecular Properties
| Compound Name | ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate |
| PubChem CID | 88883424 |
| Molecular Formula | C22H41NO6 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(N)C(CCC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41NO6/c1-20(2,3)27-17(24)12-10-15(14-19(26)29-22(7,8)9)16(23)11-13-18(25)28-21(4,5)6/h15-16H,10-14,23H2,1-9H3 |
| InChIKey | HJULHRXKLUNIPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate?
The IUPAC name of ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate (CID 88883424) is ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate.
What is the SMILES notation for ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate?
The canonical SMILES for ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate is CC(C)(C)OC(=O)CCC(N)C(CCC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate?
The InChIKey is HJULHRXKLUNIPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41NO6/c1-20(2,3)27-17(24)12-10-15(14-19(26)29-22(7,8)9)16(23)11-13-18(25)28-21(4,5)6/h15-16H,10-14,23H2,1-9H3.
What are the key properties of ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate?
ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate has a molecular weight of 415.57 g/mol, XLogP of 3.91, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-amino-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]octanedioate is sourced from PubChem (CID 88883424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).