C14H26O4S — CID 54099863
ditert-butyl 2-(sulfanylmethyl)pentanedioate (PubChem CID 54099863) has the molecular formula C14H26O4S and a molecular weight of 290.43 g/mol. Its IUPAC name is ditert-butyl 2-(sulfanylmethyl)pentanedioate.
| Compound Name | ditert-butyl 2-(sulfanylmethyl)pentanedioate |
|---|---|
| PubChem CID | 54099863 |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ditert-butyl 2-(sulfanylmethyl)pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(CS)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26O4S/c1-13(2,3)17-11(15)8-7-10(9-19)12(16)18-14(4,5)6/h10,19H,7-9H2,1-6H3 |
| InChIKey | MZUHHQPGUIZJOZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|