C25H51N3O7 — CID 177342324
5-O-tert-butyl 1-O-methyl 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate;ethane (PubChem CID 177342324) has the molecular formula C25H51N3O7 and a molecular weight of 505.70 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate;ethane.
| Compound Name | 5-O-tert-butyl 1-O-methyl 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate;ethane |
|---|---|
| PubChem CID | 177342324 |
| Molecular Formula | C25H51N3O7 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.37 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate;ethane |
| SMILES | CC.CC.COC(=O)C(CCC(=O)OC(C)(C)C)NC(=O)NC(CCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N3O7.2C2H6/c1-20(2,3)30-16(25)12-11-15(17(26)29-7)24-19(28)23-14(10-8-9-13-22)18(27)31-21(4,5)6;2*1-2/h14-15H,8-13,22H2,1-7H3,(H2,23,24,28);2*1-2H3 |
| InChIKey | OZJHVPUZBLFJSO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|