C24H47N3O7 — CID 143672013
tert-butyl 6-amino-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoylamino]hexanoate;tert-butyl propanoate (PubChem CID 143672013) has the molecular formula C24H47N3O7 and a molecular weight of 489.65 g/mol. Its IUPAC name is tert-butyl 6-amino-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoylamino]hexanoate;tert-butyl propanoate.
| Compound Name | tert-butyl 6-amino-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoylamino]hexanoate;tert-butyl propanoate |
|---|---|
| PubChem CID | 143672013 |
| Molecular Formula | C24H47N3O7 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | tert-butyl 6-amino-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoylamino]hexanoate;tert-butyl propanoate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)NC(CCCCN)C(=O)OC(C)(C)C.CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H33N3O5.C7H14O2/c1-16(2,3)24-13(21)11-19-15(23)20-12(9-7-8-10-18)14(22)25-17(4,5)6;1-5-6(8)9-7(2,3)4/h12H,7-11,18H2,1-6H3,(H2,19,20,23);5H2,1-4H3 |
| InChIKey | IRMQMIMZQGFNRM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|