C30H55N3O8 — CID 158728736
ditert-butyl (2S)-2-[[(2S)-12-amino-1-[(2-methylpropan-2-yl)oxy]-1,5-dioxododecan-2-yl]carbamoylamino]pentanedioate (PubChem CID 158728736) has the molecular formula C30H55N3O8 and a molecular weight of 585.78 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-12-amino-1-[(2-methylpropan-2-yl)oxy]-1,5-dioxododecan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-12-amino-1-[(2-methylpropan-2-yl)oxy]-1,5-dioxododecan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 158728736 |
| Molecular Formula | C30H55N3O8 |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-12-amino-1-[(2-methylpropan-2-yl)oxy]-1,5-dioxododecan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(=O)CCCCCCCN)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H55N3O8/c1-28(2,3)39-24(35)19-18-23(26(37)41-30(7,8)9)33-27(38)32-22(25(36)40-29(4,5)6)17-16-21(34)15-13-11-10-12-14-20-31/h22-23H,10-20,31H2,1-9H3,(H2,32,33,38)/t22-,23-/m0/s1 |
| InChIKey | SHTXIXCJUZKZGE-GOTSBHOMSA-N |
| XLogP | 4.48 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|