C32H58N6O7 — CID 121295137
ditert-butyl (2S)-2-[[(2S)-6-[4-(6-aminohexyl)triazol-1-yl]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 121295137) has the molecular formula C32H58N6O7 and a molecular weight of 638.85 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[4-(6-aminohexyl)triazol-1-yl]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[4-(6-aminohexyl)triazol-1-yl]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 121295137 |
| Molecular Formula | C32H58N6O7 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.44 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[4-(6-aminohexyl)triazol-1-yl]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCn1cc(CCCCCCN)nn1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H58N6O7/c1-30(2,3)43-26(39)19-18-25(28(41)45-32(7,8)9)35-29(42)34-24(27(40)44-31(4,5)6)17-13-15-21-38-22-23(36-37-38)16-12-10-11-14-20-33/h22,24-25H,10-21,33H2,1-9H3,(H2,34,35,42)/t24-,25-/m0/s1 |
| InChIKey | SAKDXVOCNQHFJP-DQEYMECFSA-N |
| XLogP | 4.35 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|