C35H55N7O10 — CID 162223312
ditert-butyl (2S)-2-[[(3S)-7-[4-[3-(2,4-dinitrophenyl)propoxymethyl]triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate (PubChem CID 162223312) has the molecular formula C35H55N7O10 and a molecular weight of 733.86 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(3S)-7-[4-[3-(2,4-dinitrophenyl)propoxymethyl]triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(3S)-7-[4-[3-(2,4-dinitrophenyl)propoxymethyl]triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 162223312 |
| Molecular Formula | C35H55N7O10 |
| Molecular Weight | 733.86 g/mol |
| Exact Mass | 733.40 |
| IUPAC Name | ditert-butyl (2S)-2-[[(3S)-7-[4-[3-(2,4-dinitrophenyl)propoxymethyl]triazol-1-yl]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCn1cc(COCCCc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])nn1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H55N7O10/c1-33(2,3)29(37-32(45)36-27(31(44)52-35(7,8)9)17-18-30(43)51-34(4,5)6)14-10-11-19-40-22-25(38-39-40)23-50-20-12-13-24-15-16-26(41(46)47)21-28(24)42(48)49/h15-16,21-22,27,29H,10-14,17-20,23H2,1-9H3,(H2,36,37,45)/t27-,29-/m0/s1 |
| InChIKey | YBHVMLTZGRIZHB-YTMVLYRLSA-N |
| XLogP | 5.96 |
| TPSA | 219.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.86 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|