C29H42N8O12 — CID 138605924
(2S)-2-[[(1S)-1-carboxy-5-[4-[2-[3-(2,4-dinitroanilino)-3-methylbutoxy]-2-methylpropyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 138605924) has the molecular formula C29H42N8O12 and a molecular weight of 694.70 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[4-[2-[3-(2,4-dinitroanilino)-3-methylbutoxy]-2-methylpropyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[4-[2-[3-(2,4-dinitroanilino)-3-methylbutoxy]-2-methylpropyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 138605924 |
| Molecular Formula | C29H42N8O12 |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 694.29 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[4-[2-[3-(2,4-dinitroanilino)-3-methylbutoxy]-2-methylpropyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(C)(CCOC(C)(C)Cc1cn(CCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)nn1)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H42N8O12/c1-28(2,32-20-9-8-19(36(45)46)15-23(20)37(47)48)12-14-49-29(3,4)16-18-17-35(34-33-18)13-6-5-7-21(25(40)41)30-27(44)31-22(26(42)43)10-11-24(38)39/h8-9,15,17,21-22,32H,5-7,10-14,16H2,1-4H3,(H,38,39)(H,40,41)(H,42,43)(H2,30,31,44)/t21-,22-/m0/s1 |
| InChIKey | YHWNQWPPENFMAF-VXKWHMMOSA-N |
| XLogP | 2.95 |
| TPSA | 291.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|