C32H42N8O15 — CID 122631281
(2S)-2-[3-[1-carboxy-5-[4-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxymethyl]triazol-1-yl]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 122631281) has the molecular formula C32H42N8O15 and a molecular weight of 778.73 g/mol. Its IUPAC name is (2S)-2-[3-[1-carboxy-5-[4-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxymethyl]triazol-1-yl]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[3-[1-carboxy-5-[4-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxymethyl]triazol-1-yl]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 122631281 |
| Molecular Formula | C32H42N8O15 |
| Molecular Weight | 778.73 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | (2S)-2-[3-[1-carboxy-5-[4-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxymethyl]triazol-1-yl]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | CCC1(CC)C(=O)N(C(CCCCn2cc(COCCOCCNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])nn2)C(=O)O)C(=O)N([C@@H](CCC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C32H42N8O15/c1-3-32(4-2)29(47)37(31(49)38(30(32)48)24(28(45)46)10-11-26(41)42)23(27(43)44)7-5-6-13-36-18-20(34-35-36)19-55-16-15-54-14-12-33-22-9-8-21(39(50)51)17-25(22)40(52)53/h8-9,17-18,23-24,33H,3-7,10-16,19H2,1-2H3,(H,41,42)(H,43,44)(H,45,46)/t23?,24-/m0/s1 |
| InChIKey | CYRXBMMKTFJROI-CGAIIQECSA-N |
| XLogP | 2.28 |
| TPSA | 317.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|