C23H26N4O13 — CID 71275712
(2S)-2-[3-[(1S)-1-carboxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 71275712) has the molecular formula C23H26N4O13 and a molecular weight of 566.48 g/mol. Its IUPAC name is (2S)-2-[3-[(1S)-1-carboxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[3-[(1S)-1-carboxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 71275712 |
| Molecular Formula | C23H26N4O13 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (2S)-2-[3-[(1S)-1-carboxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](C(=O)O)N1C(=O)CC(=O)N([C@@H](CCCCNC(=O)OCc2ccc([N+](=O)[O-])cc2)C(=O)O)C1=O |
| InChI | InChI=1S/C23H26N4O13/c28-17-11-18(29)26(16(21(34)35)8-9-19(30)31)23(37)25(17)15(20(32)33)3-1-2-10-24-22(36)40-12-13-4-6-14(7-5-13)27(38)39/h4-7,15-16H,1-3,8-12H2,(H,24,36)(H,30,31)(H,32,33)(H,34,35)/t15-,16-/m0/s1 |
| InChIKey | MESVMFPJURVQHD-HOTGVXAUSA-N |
| XLogP | 0.94 |
| TPSA | 251.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|