C19H26N4O7 — CID 10342175
(2S)-1-[2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 10342175) has the molecular formula C19H26N4O7 and a molecular weight of 422.44 g/mol. Its IUPAC name is (2S)-1-[2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10342175 |
| Molecular Formula | C19H26N4O7 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2S)-1-[2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(CCCCNC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H26N4O7/c20-15(17(24)22-11-3-5-16(22)18(25)26)4-1-2-10-21-19(27)30-12-13-6-8-14(9-7-13)23(28)29/h6-9,15-16H,1-5,10-12,20H2,(H,21,27)(H,25,26)/t15?,16-/m0/s1 |
| InChIKey | GVGIRMXNFKCASG-LYKKTTPLSA-N |
| XLogP | 1.39 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|