C37H51N9O9 — CID 173477732
benzyl 2-[[1-[1-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate (PubChem CID 173477732) has the molecular formula C37H51N9O9 and a molecular weight of 765.87 g/mol. Its IUPAC name is benzyl 2-[[1-[1-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate.
| Compound Name | benzyl 2-[[1-[1-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 173477732 |
| Molecular Formula | C37H51N9O9 |
| Molecular Weight | 765.87 g/mol |
| Exact Mass | 765.38 |
| IUPAC Name | benzyl 2-[[1-[1-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
| SMILES | N/C(=N\[N+](=O)[O-])NCCCC(NC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(N)CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H51N9O9/c38-28(16-7-8-20-41-37(51)55-25-27-14-5-2-6-15-27)33(48)45-23-11-19-31(45)34(49)44-22-10-18-30(44)32(47)42-29(17-9-21-40-36(39)43-46(52)53)35(50)54-24-26-12-3-1-4-13-26/h1-6,12-15,28-31H,7-11,16-25,38H2,(H,41,51)(H,42,47)(H3,39,40,43) |
| InChIKey | GKAZRSQAFPRNNV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 253.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.87 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|