C36H56N8O8 — CID 172974558
benzyl 2-[2-[1-[1-[2-[(2-amino-3-methylbutanoyl)amino]heptanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(Z)-N'-nitrocarbamimidoyl]amino]pentanoate (PubChem CID 172974558) has the molecular formula C36H56N8O8 and a molecular weight of 728.89 g/mol. Its IUPAC name is benzyl 2-[2-[1-[1-[2-[(2-amino-3-methylbutanoyl)amino]heptanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(Z)-N'-nitrocarbamimidoyl]amino]pentanoate.
| Compound Name | benzyl 2-[2-[1-[1-[2-[(2-amino-3-methylbutanoyl)amino]heptanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(Z)-N'-nitrocarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 172974558 |
| Molecular Formula | C36H56N8O8 |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 728.42 |
| IUPAC Name | benzyl 2-[2-[1-[1-[2-[(2-amino-3-methylbutanoyl)amino]heptanoyl]pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(Z)-N'-nitrocarbamimidoyl]amino]pentanoate |
| SMILES | CCCCCC(NC(=O)C(N)C(C)C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)CC(CCCN/C(N)=N\[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H56N8O8/c1-4-5-7-16-27(40-32(46)31(37)24(2)3)33(47)43-21-12-18-29(43)34(48)42-20-11-17-28(42)30(45)22-26(15-10-19-39-36(38)41-44(50)51)35(49)52-23-25-13-8-6-9-14-25/h6,8-9,13-14,24,26-29,31H,4-5,7,10-12,15-23,37H2,1-3H3,(H,40,46)(H3,38,39,41) |
| InChIKey | VHRWEHYTBNKDBD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 232.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|