C37H57N7O8 — CID 137139960
benzyl 2-[2-[1-[1-(5-amino-6-methyl-4-oxo-2-pentylheptanoyl)pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate (PubChem CID 137139960) has the molecular formula C37H57N7O8 and a molecular weight of 727.90 g/mol. Its IUPAC name is benzyl 2-[2-[1-[1-(5-amino-6-methyl-4-oxo-2-pentylheptanoyl)pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate.
| Compound Name | benzyl 2-[2-[1-[1-(5-amino-6-methyl-4-oxo-2-pentylheptanoyl)pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 137139960 |
| Molecular Formula | C37H57N7O8 |
| Molecular Weight | 727.90 g/mol |
| Exact Mass | 727.43 |
| IUPAC Name | benzyl 2-[2-[1-[1-(5-amino-6-methyl-4-oxo-2-pentylheptanoyl)pyrrolidine-2-carbonyl]pyrrolidin-2-yl]-2-oxoethyl]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
| SMILES | CCCCCC(CC(=O)C(N)C(C)C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)CC(CCCN/C(N)=N/[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H57N7O8/c1-4-5-7-15-27(22-32(46)33(38)25(2)3)34(47)43-21-12-18-30(43)35(48)42-20-11-17-29(42)31(45)23-28(16-10-19-40-37(39)41-44(50)51)36(49)52-24-26-13-8-6-9-14-26/h6,8-9,13-14,25,27-30,33H,4-5,7,10-12,15-24,38H2,1-3H3,(H3,39,40,41) |
| InChIKey | UHNHUXVWPQOJBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 220.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|