C28H41FN4O5 — CID 158268787
benzyl (3R)-3-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidine-1-carbonyl]-5-methylhexanoate (PubChem CID 158268787) has the molecular formula C28H41FN4O5 and a molecular weight of 532.66 g/mol. Its IUPAC name is benzyl (3R)-3-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidine-1-carbonyl]-5-methylhexanoate.
| Compound Name | benzyl (3R)-3-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidine-1-carbonyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 158268787 |
| Molecular Formula | C28H41FN4O5 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | benzyl (3R)-3-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidine-1-carbonyl]-5-methylhexanoate |
| SMILES | CC(C)C[C@H](CC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)C[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C28H41FN4O5/c1-19(2)14-22(16-26(36)38-18-20-8-4-3-5-9-20)27(37)33-13-7-11-23(33)24(34)15-21(25(35)17-29)10-6-12-32-28(30)31/h3-5,8-9,19,21-23H,6-7,10-18H2,1-2H3,(H4,30,31,32)/t21-,22-,23+/m1/s1 |
| InChIKey | RLNRQMMLRDCNEA-ZLNRFVROSA-N |
| XLogP | 2.94 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|