C29H41BrFN5O4 — CID 158121165
4-bromo-N-[(2S)-3-cyclohexyl-1-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]benzamide (PubChem CID 158121165) has the molecular formula C29H41BrFN5O4 and a molecular weight of 622.58 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-3-cyclohexyl-1-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-bromo-N-[(2S)-3-cyclohexyl-1-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 158121165 |
| Molecular Formula | C29H41BrFN5O4 |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 4-bromo-N-[(2S)-3-cyclohexyl-1-[(2S)-2-[(3R)-6-(diaminomethylideneamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]benzamide |
| SMILES | NC(N)=NCCC[C@H](CC(=O)[C@@H]1CCCN1C(=O)[C@H](CC1CCCCC1)NC(=O)c1ccc(Br)cc1)C(=O)CF |
| InChI | InChI=1S/C29H41BrFN5O4/c30-22-12-10-20(11-13-22)27(39)35-23(16-19-6-2-1-3-7-19)28(40)36-15-5-9-24(36)25(37)17-21(26(38)18-31)8-4-14-34-29(32)33/h10-13,19,21,23-24H,1-9,14-18H2,(H,35,39)(H4,32,33,34)/t21-,23+,24+/m1/s1 |
| InChIKey | SSIQPIHOZYQAIN-NHTMILBNSA-N |
| XLogP | 3.68 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|