C26H36BrFN6O4 — CID 126678433
(2S)-1-[1-[(4-bromobenzoyl)amino]cyclohexanecarbonyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 126678433) has the molecular formula C26H36BrFN6O4 and a molecular weight of 595.51 g/mol. Its IUPAC name is (2S)-1-[1-[(4-bromobenzoyl)amino]cyclohexanecarbonyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[1-[(4-bromobenzoyl)amino]cyclohexanecarbonyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126678433 |
| Molecular Formula | C26H36BrFN6O4 |
| Molecular Weight | 595.51 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | (2S)-1-[1-[(4-bromobenzoyl)amino]cyclohexanecarbonyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)C1(NC(=O)c2ccc(Br)cc2)CCCCC1)C(=O)CF |
| InChI | InChI=1S/C26H36BrFN6O4/c27-18-10-8-17(9-11-18)22(36)33-26(12-2-1-3-13-26)24(38)34-15-5-7-20(34)23(37)32-19(21(35)16-28)6-4-14-31-25(29)30/h8-11,19-20H,1-7,12-16H2,(H,32,37)(H,33,36)(H4,29,30,31)/t19-,20-/m0/s1 |
| InChIKey | AMOCVGZXIPKEKV-PMACEKPBSA-N |
| XLogP | 1.95 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|