C19H31FN6O5 — CID 135315242
[1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidine-1-carbonyl]cyclopentyl]carbamic acid (PubChem CID 135315242) has the molecular formula C19H31FN6O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidine-1-carbonyl]cyclopentyl]carbamic acid.
| Compound Name | [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidine-1-carbonyl]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 135315242 |
| Molecular Formula | C19H31FN6O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidine-1-carbonyl]cyclopentyl]carbamic acid |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CCCN1C(=O)C1(NC(=O)O)CCCC1)C(=O)CF |
| InChI | InChI=1S/C19H31FN6O5/c20-11-14(27)12(5-3-9-23-17(21)22)24-15(28)13-6-4-10-26(13)16(29)19(25-18(30)31)7-1-2-8-19/h12-13,25H,1-11H2,(H,24,28)(H,30,31)(H4,21,22,23)/t12?,13-/m0/s1 |
| InChIKey | HTLOJHVBPDGTSB-ABLWVSNPSA-N |
| XLogP | -0.37 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|