C18H31IN6O3 — CID 163893375
(2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(iodoamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide (PubChem CID 163893375) has the molecular formula C18H31IN6O3 and a molecular weight of 506.39 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(iodoamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(iodoamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163893375 |
| Molecular Formula | C18H31IN6O3 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(iodoamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)[C@@H]1CCCN1C(=O)C1(NI)CCCCC1 |
| InChI | InChI=1S/C18H31IN6O3/c19-24-18(8-2-1-3-9-18)16(28)25-11-5-7-14(25)15(27)23-13(12-26)6-4-10-22-17(20)21/h12-14,24H,1-11H2,(H,23,27)(H4,20,21,22)/t13-,14-/m0/s1 |
| InChIKey | QDMIEBHFXABAGM-KBPBESRZSA-N |
| XLogP | 0.36 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|